C28H28N6O3 — CID 58427268
(2R)-3-azido-2-[[[2-[[(2R)-1-benzylpyrrolidine-2-carbonyl]amino]phenyl]-phenylmethylidene]amino]propanoic acid (PubChem CID 58427268) has the molecular formula C28H28N6O3 and a molecular weight of 496.57 g/mol. Its IUPAC name is (2R)-3-azido-2-[[[2-[[(2R)-1-benzylpyrrolidine-2-carbonyl]amino]phenyl]-phenylmethylidene]amino]propanoic acid.
| Compound Name | (2R)-3-azido-2-[[[2-[[(2R)-1-benzylpyrrolidine-2-carbonyl]amino]phenyl]-phenylmethylidene]amino]propanoic acid |
|---|---|
| PubChem CID | 58427268 |
| Molecular Formula | C28H28N6O3 |
| Molecular Weight | 496.57 g/mol |
| Exact Mass | 496.22 |
| IUPAC Name | (2R)-3-azido-2-[[[2-[[(2R)-1-benzylpyrrolidine-2-carbonyl]amino]phenyl]-phenylmethylidene]amino]propanoic acid |
| SMILES | [N-]=[N+]=NC[C@@H](/N=C(\c1ccccc1)c1ccccc1NC(=O)[C@H]1CCCN1Cc1ccccc1)C(=O)O |
| InChI | InChI=1S/C28H28N6O3/c29-33-30-18-24(28(36)37)31-26(21-12-5-2-6-13-21)22-14-7-8-15-23(22)32-27(35)25-16-9-17-34(25)19-20-10-3-1-4-11-20/h1-8,10-15,24-25H,9,16-19H2,(H,32,35)(H,36,37)/b31-26+/t24-,25-/m1/s1 |
| InChIKey | AGRVHAUTVGBPBU-DFNPCSNQSA-N |
| XLogP | 4.89 |
| TPSA | 130.76 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 37 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 496.57 |
| LogP ≤ 5 | 4.89 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|