C28H29N3O3 — CID 10907370
2-[[[2-[[(2S)-1-benzylpyrrolidine-2-carbonyl]amino]-4-methylphenyl]-phenylmethylidene]amino]acetic acid (PubChem CID 10907370) has the molecular formula C28H29N3O3 and a molecular weight of 455.56 g/mol. Its IUPAC name is 2-[[[2-[[(2S)-1-benzylpyrrolidine-2-carbonyl]amino]-4-methylphenyl]-phenylmethylidene]amino]acetic acid.
| Compound Name | 2-[[[2-[[(2S)-1-benzylpyrrolidine-2-carbonyl]amino]-4-methylphenyl]-phenylmethylidene]amino]acetic acid |
|---|---|
| PubChem CID | 10907370 |
| Molecular Formula | C28H29N3O3 |
| Molecular Weight | 455.56 g/mol |
| Exact Mass | 455.22 |
| IUPAC Name | 2-[[[2-[[(2S)-1-benzylpyrrolidine-2-carbonyl]amino]-4-methylphenyl]-phenylmethylidene]amino]acetic acid |
| SMILES | Cc1ccc(/C(=N/CC(=O)O)c2ccccc2)c(NC(=O)[C@@H]2CCCN2Cc2ccccc2)c1 |
| InChI | InChI=1S/C28H29N3O3/c1-20-14-15-23(27(29-18-26(32)33)22-11-6-3-7-12-22)24(17-20)30-28(34)25-13-8-16-31(25)19-21-9-4-2-5-10-21/h2-7,9-12,14-15,17,25H,8,13,16,18-19H2,1H3,(H,30,34)(H,32,33)/b29-27+/t25-/m0/s1 |
| InChIKey | VWLPFWUJRJFZHD-FNLQBEHQSA-N |
| XLogP | 4.52 |
| TPSA | 82.00 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 455.56 |
| LogP ≤ 5 | 4.52 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|