C27H26ClN3O3 — CID 24987704
2-[[[2-[[(2R)-1-benzylpyrrolidine-2-carbonyl]amino]-5-chlorophenyl]-phenylmethylidene]amino]acetic acid (PubChem CID 24987704) has the molecular formula C27H26ClN3O3 and a molecular weight of 475.98 g/mol. Its IUPAC name is 2-[[[2-[[(2R)-1-benzylpyrrolidine-2-carbonyl]amino]-5-chlorophenyl]-phenylmethylidene]amino]acetic acid.
| Compound Name | 2-[[[2-[[(2R)-1-benzylpyrrolidine-2-carbonyl]amino]-5-chlorophenyl]-phenylmethylidene]amino]acetic acid |
|---|---|
| PubChem CID | 24987704 |
| Molecular Formula | C27H26ClN3O3 |
| Molecular Weight | 475.98 g/mol |
| Exact Mass | 475.17 |
| IUPAC Name | 2-[[[2-[[(2R)-1-benzylpyrrolidine-2-carbonyl]amino]-5-chlorophenyl]-phenylmethylidene]amino]acetic acid |
| SMILES | O=C(O)C/N=C(\c1ccccc1)c1cc(Cl)ccc1NC(=O)[C@H]1CCCN1Cc1ccccc1 |
| InChI | InChI=1S/C27H26ClN3O3/c28-21-13-14-23(22(16-21)26(29-17-25(32)33)20-10-5-2-6-11-20)30-27(34)24-12-7-15-31(24)18-19-8-3-1-4-9-19/h1-6,8-11,13-14,16,24H,7,12,15,17-18H2,(H,30,34)(H,32,33)/b29-26+/t24-/m1/s1 |
| InChIKey | HPQAVPKOKOQSGI-WCWATDFMSA-N |
| XLogP | 4.87 |
| TPSA | 82.00 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 475.98 |
| LogP ≤ 5 | 4.87 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|