C27H27N3O3 — CID 150505610
2-[[2-[2-[[(2R)-1-benzylpyrrolidine-2-carbonyl]amino]phenyl]phenyl]methylideneamino]acetic acid (PubChem CID 150505610) has the molecular formula C27H27N3O3 and a molecular weight of 441.53 g/mol. Its IUPAC name is 2-[[2-[2-[[(2R)-1-benzylpyrrolidine-2-carbonyl]amino]phenyl]phenyl]methylideneamino]acetic acid.
| Compound Name | 2-[[2-[2-[[(2R)-1-benzylpyrrolidine-2-carbonyl]amino]phenyl]phenyl]methylideneamino]acetic acid |
|---|---|
| PubChem CID | 150505610 |
| Molecular Formula | C27H27N3O3 |
| Molecular Weight | 441.53 g/mol |
| Exact Mass | 441.21 |
| IUPAC Name | 2-[[2-[2-[[(2R)-1-benzylpyrrolidine-2-carbonyl]amino]phenyl]phenyl]methylideneamino]acetic acid |
| SMILES | O=C(O)C/N=C/c1ccccc1-c1ccccc1NC(=O)[C@H]1CCCN1Cc1ccccc1 |
| InChI | InChI=1S/C27H27N3O3/c31-26(32)18-28-17-21-11-4-5-12-22(21)23-13-6-7-14-24(23)29-27(33)25-15-8-16-30(25)19-20-9-2-1-3-10-20/h1-7,9-14,17,25H,8,15-16,18-19H2,(H,29,33)(H,31,32)/b28-17+/t25-/m1/s1 |
| InChIKey | HYSYIYVBXPNYNI-GLYRRZRCSA-N |
| XLogP | 4.46 |
| TPSA | 82.00 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 441.53 |
| LogP ≤ 5 | 4.46 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|