C27H29N3O — CID 89270517
1-benzyl-N-[2-(N-ethyl-C-phenylcarbonimidoyl)phenyl]pyrrolidine-2-carboxamide (PubChem CID 89270517) has the molecular formula C27H29N3O and a molecular weight of 411.55 g/mol. Its IUPAC name is 1-benzyl-N-[2-(N-ethyl-C-phenylcarbonimidoyl)phenyl]pyrrolidine-2-carboxamide.
| Compound Name | 1-benzyl-N-[2-(N-ethyl-C-phenylcarbonimidoyl)phenyl]pyrrolidine-2-carboxamide |
|---|---|
| PubChem CID | 89270517 |
| Molecular Formula | C27H29N3O |
| Molecular Weight | 411.55 g/mol |
| Exact Mass | 411.23 |
| IUPAC Name | 1-benzyl-N-[2-(N-ethyl-C-phenylcarbonimidoyl)phenyl]pyrrolidine-2-carboxamide |
| SMILES | CC/N=C(\c1ccccc1)c1ccccc1NC(=O)C1CCCN1Cc1ccccc1 |
| InChI | InChI=1S/C27H29N3O/c1-2-28-26(22-14-7-4-8-15-22)23-16-9-10-17-24(23)29-27(31)25-18-11-19-30(25)20-21-12-5-3-6-13-21/h3-10,12-17,25H,2,11,18-20H2,1H3,(H,29,31)/b28-26+ |
| InChIKey | YNELDUQBDNBYIV-BYCLXTJYSA-N |
| XLogP | 5.15 |
| TPSA | 44.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 411.55 |
| LogP ≤ 5 | 5.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|