C34H37N3O3 — CID 153433588
(2R)-2-[[[2-[(1-benzylpyrrolidine-2-carbonyl)amino]phenyl]-phenylmethylidene]amino]-2-methyloct-6-ynoic acid (PubChem CID 153433588) has the molecular formula C34H37N3O3 and a molecular weight of 535.69 g/mol. Its IUPAC name is (2R)-2-[[[2-[(1-benzylpyrrolidine-2-carbonyl)amino]phenyl]-phenylmethylidene]amino]-2-methyloct-6-ynoic acid.
| Compound Name | (2R)-2-[[[2-[(1-benzylpyrrolidine-2-carbonyl)amino]phenyl]-phenylmethylidene]amino]-2-methyloct-6-ynoic acid |
|---|---|
| PubChem CID | 153433588 |
| Molecular Formula | C34H37N3O3 |
| Molecular Weight | 535.69 g/mol |
| Exact Mass | 535.28 |
| IUPAC Name | (2R)-2-[[[2-[(1-benzylpyrrolidine-2-carbonyl)amino]phenyl]-phenylmethylidene]amino]-2-methyloct-6-ynoic acid |
| SMILES | CC#CCCC[C@@](C)(/N=C(\c1ccccc1)c1ccccc1NC(=O)C1CCCN1Cc1ccccc1)C(=O)O |
| InChI | InChI=1S/C34H37N3O3/c1-3-4-5-14-23-34(2,33(39)40)36-31(27-18-10-7-11-19-27)28-20-12-13-21-29(28)35-32(38)30-22-15-24-37(30)25-26-16-8-6-9-17-26/h6-13,16-21,30H,5,14-15,22-25H2,1-2H3,(H,35,38)(H,39,40)/b36-31+/t30?,34-/m1/s1 |
| InChIKey | KFFFEUGGNNPQBP-RIJRGHRVSA-N |
| XLogP | 6.16 |
| TPSA | 82.00 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 535.69 |
| LogP ≤ 5 | 6.16 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|