C28H28N3NiO3- — CID 91653758
(1-benzylpyrrolidine-2-carbonyl)-[2-[N-(carboxymethyl)-C-phenylcarbonimidoyl]-4-methylphenyl]azanide;nickel (PubChem CID 91653758) has the molecular formula C28H28N3NiO3- and a molecular weight of 513.24 g/mol. Its IUPAC name is (1-benzylpyrrolidine-2-carbonyl)-[2-[N-(carboxymethyl)-C-phenylcarbonimidoyl]-4-methylphenyl]azanide;nickel.
| Compound Name | (1-benzylpyrrolidine-2-carbonyl)-[2-[N-(carboxymethyl)-C-phenylcarbonimidoyl]-4-methylphenyl]azanide;nickel |
|---|---|
| PubChem CID | 91653758 |
| Molecular Formula | C28H28N3NiO3- |
| Molecular Weight | 513.24 g/mol |
| Exact Mass | 512.15 |
| IUPAC Name | (1-benzylpyrrolidine-2-carbonyl)-[2-[N-(carboxymethyl)-C-phenylcarbonimidoyl]-4-methylphenyl]azanide;nickel |
| SMILES | Cc1ccc([N-]C(=O)C2CCCN2Cc2ccccc2)c(/C(=N\CC(=O)O)c2ccccc2)c1.[Ni] |
| InChI | InChI=1S/C28H29N3O3.Ni/c1-20-14-15-24(23(17-20)27(29-18-26(32)33)22-11-6-3-7-12-22)30-28(34)25-13-8-16-31(25)19-21-9-4-2-5-10-21;/h2-7,9-12,14-15,17,25H,8,13,16,18-19H2,1H3,(H2,29,30,32,33,34);/p-1 |
| InChIKey | JBWSGBXAQUVFQB-UHFFFAOYSA-M |
| XLogP | 5.11 |
| TPSA | 84.07 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 513.24 |
| LogP ≤ 5 | 5.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|