C31H33N6NiO3+ — CID 140747013
[2-[N-[(1S)-5-azido-1-carboxypentyl]-C-phenylcarbonimidoyl]phenyl]-[(2R)-1-benzylpyrrolidine-2-carbonyl]azanide;nickel(2+) (PubChem CID 140747013) has the molecular formula C31H33N6NiO3+ and a molecular weight of 596.34 g/mol. Its IUPAC name is [2-[N-[(1S)-5-azido-1-carboxypentyl]-C-phenylcarbonimidoyl]phenyl]-[(2R)-1-benzylpyrrolidine-2-carbonyl]azanide;nickel(2+).
| Compound Name | [2-[N-[(1S)-5-azido-1-carboxypentyl]-C-phenylcarbonimidoyl]phenyl]-[(2R)-1-benzylpyrrolidine-2-carbonyl]azanide;nickel(2+) |
|---|---|
| PubChem CID | 140747013 |
| Molecular Formula | C31H33N6NiO3+ |
| Molecular Weight | 596.34 g/mol |
| Exact Mass | 595.20 |
| IUPAC Name | [2-[N-[(1S)-5-azido-1-carboxypentyl]-C-phenylcarbonimidoyl]phenyl]-[(2R)-1-benzylpyrrolidine-2-carbonyl]azanide;nickel(2+) |
| SMILES | [N-]=[N+]=NCCCC[C@H](/N=C(\c1ccccc1)c1ccccc1[N-]C(=O)[C@H]1CCCN1Cc1ccccc1)C(=O)O.[Ni+2] |
| InChI | InChI=1S/C31H34N6O3.Ni/c32-36-33-20-10-9-18-27(31(39)40)34-29(24-14-5-2-6-15-24)25-16-7-8-17-26(25)35-30(38)28-19-11-21-37(28)22-23-12-3-1-4-13-23;/h1-8,12-17,27-28H,9-11,18-22H2,(H2,34,35,38,39,40);/q;+2/p-1/t27-,28+;/m0./s1 |
| InChIKey | ILHNRMUVEVSMLG-DUZWKJOOSA-M |
| XLogP | 6.65 |
| TPSA | 132.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 596.34 |
| LogP ≤ 5 | 6.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|