C18H23NO2 — CID 101015741
(3E)-3-[(2E,4E)-hexa-2,4-dienylidene]-2-oxo-N,N-bis(prop-2-enyl)cyclopentane-1-carboxamide (PubChem CID 101015741) has the molecular formula C18H23NO2 and a molecular weight of 285.39 g/mol. Its IUPAC name is (3E)-3-[(2E,4E)-hexa-2,4-dienylidene]-2-oxo-N,N-bis(prop-2-enyl)cyclopentane-1-carboxamide.
| Compound Name | (3E)-3-[(2E,4E)-hexa-2,4-dienylidene]-2-oxo-N,N-bis(prop-2-enyl)cyclopentane-1-carboxamide |
|---|---|
| PubChem CID | 101015741 |
| Molecular Formula | C18H23NO2 |
| Molecular Weight | 285.39 g/mol |
| Exact Mass | 285.17 |
| IUPAC Name | (3E)-3-[(2E,4E)-hexa-2,4-dienylidene]-2-oxo-N,N-bis(prop-2-enyl)cyclopentane-1-carboxamide |
| SMILES | C=CCN(CC=C)C(=O)C1CC/C(=C\C=C\C=C\C)C1=O |
| InChI | InChI=1S/C18H23NO2/c1-4-7-8-9-10-15-11-12-16(17(15)20)18(21)19(13-5-2)14-6-3/h4-10,16H,2-3,11-14H2,1H3/b7-4+,9-8+,15-10+ |
| InChIKey | KMSXIUQEQTUCFJ-GQBKHQTNSA-N |
| XLogP | 3.22 |
| TPSA | 37.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 285.39 |
| LogP ≤ 5 | 3.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|