C32H52N15O12Se — CID 101015808
CID 101015808 (PubChem CID 101015808) has the molecular formula C32H52N15O12Se and a molecular weight of 917.82 g/mol.
| Compound Name | CID 101015808 |
|---|---|
| PubChem CID | 101015808 |
| Molecular Formula | C32H52N15O12Se |
| Molecular Weight | 917.82 g/mol |
| Exact Mass | 918.31 |
| IUPAC Name | — |
| SMILES | C[C@H](NC(=O)CNC(=O)[C@@H](N)CC(N)=O)C(=O)N[C@@H](CCC(N)=O)C(=O)N[C@@H](C[Se])C(=O)N[C@@H](CO)C(=O)N[C@@H](CCCN=C(N)N)C(=O)N[C@@H](Cc1cnc[nH]1)C(=O)O |
| InChI | InChI=1S/C32H52N15O12Se/c1-14(42-24(51)10-40-26(53)16(33)8-23(35)50)25(52)43-18(4-5-22(34)49)28(55)47-21(12-60)30(57)46-20(11-48)29(56)44-17(3-2-6-39-32(36)37)27(54)45-19(31(58)59)7-15-9-38-13-41-15/h9,13-14,16-21,48H,2-8,10-12,33H2,1H3,(H2,34,49)(H2,35,50)(H,38,41)(H,40,53)(H,42,51)(H,43,52)(H,44,56)(H,45,54)(H,46,57)(H,47,55)(H,58,59)(H4,36,37,39)/t14-,16-,17-,18-,19-,20-,21-/m0/s1 |
| InChIKey | IPCUWIGHDWMALS-NGFSFWIMSA-N |
| XLogP | -8.82 |
| TPSA | 466.51 Ų |
| H-Bond Donors | 15 |
| H-Bond Acceptors | 14 |
| Rotatable Bonds | 28 |
| Heavy Atoms | 60 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 917.82 |
| LogP ≤ 5 | -8.82 |
| H-Bond Donors ≤ 5 | 15 |
| H-Bond Acceptors ≤ 10 | 14 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|