C19H32N10O6 — CID 22701117
2-[[2-[[5-(diaminomethylideneamino)-2-[(2,5-diamino-5-oxopentanoyl)amino]pentanoyl]amino]acetyl]amino]-3-(1H-imidazol-5-yl)propanoic acid (PubChem CID 22701117) has the molecular formula C19H32N10O6 and a molecular weight of 496.53 g/mol. Its IUPAC name is 2-[[2-[[5-(diaminomethylideneamino)-2-[(2,5-diamino-5-oxopentanoyl)amino]pentanoyl]amino]acetyl]amino]-3-(1H-imidazol-5-yl)propanoic acid.
| Compound Name | 2-[[2-[[5-(diaminomethylideneamino)-2-[(2,5-diamino-5-oxopentanoyl)amino]pentanoyl]amino]acetyl]amino]-3-(1H-imidazol-5-yl)propanoic acid |
|---|---|
| PubChem CID | 22701117 |
| Molecular Formula | C19H32N10O6 |
| Molecular Weight | 496.53 g/mol |
| Exact Mass | 496.25 |
| IUPAC Name | 2-[[2-[[5-(diaminomethylideneamino)-2-[(2,5-diamino-5-oxopentanoyl)amino]pentanoyl]amino]acetyl]amino]-3-(1H-imidazol-5-yl)propanoic acid |
| SMILES | NC(=O)CCC(N)C(=O)NC(CCCN=C(N)N)C(=O)NCC(=O)NC(Cc1cnc[nH]1)C(=O)O |
| InChI | InChI=1S/C19H32N10O6/c20-11(3-4-14(21)30)16(32)29-12(2-1-5-25-19(22)23)17(33)26-8-15(31)28-13(18(34)35)6-10-7-24-9-27-10/h7,9,11-13H,1-6,8,20H2,(H2,21,30)(H,24,27)(H,26,33)(H,28,31)(H,29,32)(H,34,35)(H4,22,23,25) |
| InChIKey | BKBBGOVLTGKVPM-UHFFFAOYSA-N |
| XLogP | -4.23 |
| TPSA | 286.79 Ų |
| H-Bond Donors | 9 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 496.53 |
| LogP ≤ 5 | -4.23 |
| H-Bond Donors ≤ 5 | 9 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|