C10H17FO2Si — CID 101017234
ethyl (2Z,4E)-3-fluoro-5-trimethylsilylpenta-2,4-dienoate (PubChem CID 101017234) has the molecular formula C10H17FO2Si and a molecular weight of 216.33 g/mol. Its IUPAC name is ethyl (2Z,4E)-3-fluoro-5-trimethylsilylpenta-2,4-dienoate.
| Compound Name | ethyl (2Z,4E)-3-fluoro-5-trimethylsilylpenta-2,4-dienoate |
|---|---|
| PubChem CID | 101017234 |
| Molecular Formula | C10H17FO2Si |
| Molecular Weight | 216.33 g/mol |
| Exact Mass | 216.10 |
| IUPAC Name | ethyl (2Z,4E)-3-fluoro-5-trimethylsilylpenta-2,4-dienoate |
| SMILES | CCOC(=O)/C=C(F)/C=C/[Si](C)(C)C |
| InChI | InChI=1S/C10H17FO2Si/c1-5-13-10(12)8-9(11)6-7-14(2,3)4/h6-8H,5H2,1-4H3/b7-6+,9-8- |
| InChIKey | PRDBYZGOILVSPM-MUIOLIGRSA-N |
| XLogP | 2.84 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 216.33 |
| LogP ≤ 5 | 2.84 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|