C11H17F3O2Si — CID 11043708
ethyl (2E,4E)-3-(trifluoromethyl)-5-trimethylsilylpenta-2,4-dienoate (PubChem CID 11043708) has the molecular formula C11H17F3O2Si and a molecular weight of 266.33 g/mol. Its IUPAC name is ethyl (2E,4E)-3-(trifluoromethyl)-5-trimethylsilylpenta-2,4-dienoate.
| Compound Name | ethyl (2E,4E)-3-(trifluoromethyl)-5-trimethylsilylpenta-2,4-dienoate |
|---|---|
| PubChem CID | 11043708 |
| Molecular Formula | C11H17F3O2Si |
| Molecular Weight | 266.33 g/mol |
| Exact Mass | 266.09 |
| IUPAC Name | ethyl (2E,4E)-3-(trifluoromethyl)-5-trimethylsilylpenta-2,4-dienoate |
| SMILES | CCOC(=O)/C=C(\C=C\[Si](C)(C)C)C(F)(F)F |
| InChI | InChI=1S/C11H17F3O2Si/c1-5-16-10(15)8-9(11(12,13)14)6-7-17(2,3)4/h6-8H,5H2,1-4H3/b7-6+,9-8+ |
| InChIKey | FZZQJCKSDFCANM-BLHCBFLLSA-N |
| XLogP | 3.47 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 266.33 |
| LogP ≤ 5 | 3.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|