C11H19IO2Si — CID 11056864
2-trimethylsilylethyl (2E,4E)-5-iodo-3-methylpenta-2,4-dienoate (PubChem CID 11056864) has the molecular formula C11H19IO2Si and a molecular weight of 338.26 g/mol. Its IUPAC name is 2-trimethylsilylethyl (2E,4E)-5-iodo-3-methylpenta-2,4-dienoate.
| Compound Name | 2-trimethylsilylethyl (2E,4E)-5-iodo-3-methylpenta-2,4-dienoate |
|---|---|
| PubChem CID | 11056864 |
| Molecular Formula | C11H19IO2Si |
| Molecular Weight | 338.26 g/mol |
| Exact Mass | 338.02 |
| IUPAC Name | 2-trimethylsilylethyl (2E,4E)-5-iodo-3-methylpenta-2,4-dienoate |
| SMILES | CC(/C=C/I)=C\C(=O)OCC[Si](C)(C)C |
| InChI | InChI=1S/C11H19IO2Si/c1-10(5-6-12)9-11(13)14-7-8-15(2,3)4/h5-6,9H,7-8H2,1-4H3/b6-5+,10-9+ |
| InChIKey | AUJHWIWLTNBLED-QPHGKBKNSA-N |
| XLogP | 3.76 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.26 |
| LogP ≤ 5 | 3.76 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|