C13H17IO2 — CID 11002079
ethyl (2E,4E,6Z,8E)-9-iodo-3,7-dimethylnona-2,4,6,8-tetraenoate (PubChem CID 11002079) has the molecular formula C13H17IO2 and a molecular weight of 332.18 g/mol. Its IUPAC name is ethyl (2E,4E,6Z,8E)-9-iodo-3,7-dimethylnona-2,4,6,8-tetraenoate.
| Compound Name | ethyl (2E,4E,6Z,8E)-9-iodo-3,7-dimethylnona-2,4,6,8-tetraenoate |
|---|---|
| PubChem CID | 11002079 |
| Molecular Formula | C13H17IO2 |
| Molecular Weight | 332.18 g/mol |
| Exact Mass | 332.03 |
| IUPAC Name | ethyl (2E,4E,6Z,8E)-9-iodo-3,7-dimethylnona-2,4,6,8-tetraenoate |
| SMILES | CCOC(=O)/C=C(C)/C=C/C=C(C)\C=C\I |
| InChI | InChI=1S/C13H17IO2/c1-4-16-13(15)10-12(3)7-5-6-11(2)8-9-14/h5-10H,4H2,1-3H3/b7-5+,9-8+,11-6-,12-10+ |
| InChIKey | PWXCGANQKDCHBJ-SIOSTYJKSA-N |
| XLogP | 3.95 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.18 |
| LogP ≤ 5 | 3.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|