C21H17F3N4O — CID 101017435
1-(8-benzyl-8,11,12,14-tetrazatetracyclo[7.7.0.01,13.02,7]hexadeca-2,4,6,10,12-pentaen-14-yl)-2,2,2-trifluoroethanone (PubChem CID 101017435) has the molecular formula C21H17F3N4O and a molecular weight of 398.39 g/mol. Its IUPAC name is 1-(8-benzyl-8,11,12,14-tetrazatetracyclo[7.7.0.01,13.02,7]hexadeca-2,4,6,10,12-pentaen-14-yl)-2,2,2-trifluoroethanone.
| Compound Name | 1-(8-benzyl-8,11,12,14-tetrazatetracyclo[7.7.0.01,13.02,7]hexadeca-2,4,6,10,12-pentaen-14-yl)-2,2,2-trifluoroethanone |
|---|---|
| PubChem CID | 101017435 |
| Molecular Formula | C21H17F3N4O |
| Molecular Weight | 398.39 g/mol |
| Exact Mass | 398.14 |
| IUPAC Name | 1-(8-benzyl-8,11,12,14-tetrazatetracyclo[7.7.0.01,13.02,7]hexadeca-2,4,6,10,12-pentaen-14-yl)-2,2,2-trifluoroethanone |
| SMILES | O=C(N1CCC23C1=NN=CC2N(Cc1ccccc1)c1ccccc13)C(F)(F)F |
| InChI | InChI=1S/C21H17F3N4O/c22-21(23,24)19(29)27-11-10-20-15-8-4-5-9-16(15)28(13-14-6-2-1-3-7-14)17(20)12-25-26-18(20)27/h1-9,12,17H,10-11,13H2 |
| InChIKey | LRFSDBYBNRQIJC-UHFFFAOYSA-N |
| XLogP | 3.51 |
| TPSA | 48.27 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.39 |
| LogP ≤ 5 | 3.51 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |