C23H25NO2 — CID 10665348
(1R,9R,12S,13S)-8-benzyl-13-hydroxy-13-methyl-8-azatetracyclo[10.3.1.01,9.02,7]hexadeca-2,4,6-trien-16-one (PubChem CID 10665348) has the molecular formula C23H25NO2 and a molecular weight of 347.46 g/mol. Its IUPAC name is (1R,9R,12S,13S)-8-benzyl-13-hydroxy-13-methyl-8-azatetracyclo[10.3.1.01,9.02,7]hexadeca-2,4,6-trien-16-one.
| Compound Name | (1R,9R,12S,13S)-8-benzyl-13-hydroxy-13-methyl-8-azatetracyclo[10.3.1.01,9.02,7]hexadeca-2,4,6-trien-16-one |
|---|---|
| PubChem CID | 10665348 |
| Molecular Formula | C23H25NO2 |
| Molecular Weight | 347.46 g/mol |
| Exact Mass | 347.19 |
| IUPAC Name | (1R,9R,12S,13S)-8-benzyl-13-hydroxy-13-methyl-8-azatetracyclo[10.3.1.01,9.02,7]hexadeca-2,4,6-trien-16-one |
| SMILES | C[C@]1(O)CC[C@]23C(=O)[C@H]1CC[C@H]2N(Cc1ccccc1)c1ccccc13 |
| InChI | InChI=1S/C23H25NO2/c1-22(26)13-14-23-17-9-5-6-10-19(17)24(15-16-7-3-2-4-8-16)20(23)12-11-18(22)21(23)25/h2-10,18,20,26H,11-15H2,1H3/t18-,20-,22+,23-/m1/s1 |
| InChIKey | ITGLUFPNMZVBTB-WENLIBGGSA-N |
| XLogP | 3.84 |
| TPSA | 40.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 347.46 |
| LogP ≤ 5 | 3.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |