C26H28N2O2 — CID 102526231
(1R,9R,12S,19S)-8-benzyl-12-ethyl-8,16-diazapentacyclo[10.6.1.01,9.02,7.016,19]nonadeca-2,4,6-triene-11,17-dione (PubChem CID 102526231) has the molecular formula C26H28N2O2 and a molecular weight of 400.52 g/mol. Its IUPAC name is (1R,9R,12S,19S)-8-benzyl-12-ethyl-8,16-diazapentacyclo[10.6.1.01,9.02,7.016,19]nonadeca-2,4,6-triene-11,17-dione.
| Compound Name | (1R,9R,12S,19S)-8-benzyl-12-ethyl-8,16-diazapentacyclo[10.6.1.01,9.02,7.016,19]nonadeca-2,4,6-triene-11,17-dione |
|---|---|
| PubChem CID | 102526231 |
| Molecular Formula | C26H28N2O2 |
| Molecular Weight | 400.52 g/mol |
| Exact Mass | 400.22 |
| IUPAC Name | (1R,9R,12S,19S)-8-benzyl-12-ethyl-8,16-diazapentacyclo[10.6.1.01,9.02,7.016,19]nonadeca-2,4,6-triene-11,17-dione |
| SMILES | CC[C@@]12CCCN3C(=O)C[C@]4(c5ccccc5N(Cc5ccccc5)[C@@H]4CC1=O)[C@H]32 |
| InChI | InChI=1S/C26H28N2O2/c1-2-25-13-8-14-27-23(30)16-26(24(25)27)19-11-6-7-12-20(19)28(21(26)15-22(25)29)17-18-9-4-3-5-10-18/h3-7,9-12,21,24H,2,8,13-17H2,1H3/t21-,24-,25-,26-/m1/s1 |
| InChIKey | JIGUAPYVMMTZRR-JLZPKONASA-N |
| XLogP | 4.08 |
| TPSA | 40.62 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.52 |
| LogP ≤ 5 | 4.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |