C23H24N2O2 — CID 101375869
(4aR,7aS,12bS)-3-benzyl-8-methyl-1,2,4a,5,7,7a-hexahydropyrido[3,4-d]carbazole-4,6-dione (PubChem CID 101375869) has the molecular formula C23H24N2O2 and a molecular weight of 360.46 g/mol. Its IUPAC name is (4aR,7aS,12bS)-3-benzyl-8-methyl-1,2,4a,5,7,7a-hexahydropyrido[3,4-d]carbazole-4,6-dione.
| Compound Name | (4aR,7aS,12bS)-3-benzyl-8-methyl-1,2,4a,5,7,7a-hexahydropyrido[3,4-d]carbazole-4,6-dione |
|---|---|
| PubChem CID | 101375869 |
| Molecular Formula | C23H24N2O2 |
| Molecular Weight | 360.46 g/mol |
| Exact Mass | 360.18 |
| IUPAC Name | (4aR,7aS,12bS)-3-benzyl-8-methyl-1,2,4a,5,7,7a-hexahydropyrido[3,4-d]carbazole-4,6-dione |
| SMILES | CN1c2ccccc2[C@]23CCN(Cc4ccccc4)C(=O)[C@@H]2CC(=O)C[C@H]13 |
| InChI | InChI=1S/C23H24N2O2/c1-24-20-10-6-5-9-18(20)23-11-12-25(15-16-7-3-2-4-8-16)22(27)19(23)13-17(26)14-21(23)24/h2-10,19,21H,11-15H2,1H3/t19-,21-,23+/m0/s1 |
| InChIKey | QIVWLHIGEHQEOW-IEIRFRATSA-N |
| XLogP | 3.15 |
| TPSA | 40.62 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.46 |
| LogP ≤ 5 | 3.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |