C21H25NO3 — CID 102494492
(3aS,8bR)-4-benzyl-8b-(2,2-dimethoxyethyl)-2,3a-dihydro-1H-furo[2,3-b]indole (PubChem CID 102494492) has the molecular formula C21H25NO3 and a molecular weight of 339.44 g/mol. Its IUPAC name is (3aS,8bR)-4-benzyl-8b-(2,2-dimethoxyethyl)-2,3a-dihydro-1H-furo[2,3-b]indole.
| Compound Name | (3aS,8bR)-4-benzyl-8b-(2,2-dimethoxyethyl)-2,3a-dihydro-1H-furo[2,3-b]indole |
|---|---|
| PubChem CID | 102494492 |
| Molecular Formula | C21H25NO3 |
| Molecular Weight | 339.44 g/mol |
| Exact Mass | 339.18 |
| IUPAC Name | (3aS,8bR)-4-benzyl-8b-(2,2-dimethoxyethyl)-2,3a-dihydro-1H-furo[2,3-b]indole |
| SMILES | COC(C[C@@]12CCO[C@@H]1N(Cc1ccccc1)c1ccccc12)OC |
| InChI | InChI=1S/C21H25NO3/c1-23-19(24-2)14-21-12-13-25-20(21)22(15-16-8-4-3-5-9-16)18-11-7-6-10-17(18)21/h3-11,19-20H,12-15H2,1-2H3/t20-,21+/m0/s1 |
| InChIKey | LBUQCIPVVZIEJL-LEWJYISDSA-N |
| XLogP | 3.70 |
| TPSA | 30.93 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 339.44 |
| LogP ≤ 5 | 3.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|