C8H11N4O3+ — CID 101018017
diaminomethylidene-(5-methoxycarbonyl-1H-pyrrole-2-carbonyl)azanium (PubChem CID 101018017) has the molecular formula C8H11N4O3+ and a molecular weight of 211.20 g/mol. Its IUPAC name is diaminomethylidene-(5-methoxycarbonyl-1H-pyrrole-2-carbonyl)azanium.
| Compound Name | diaminomethylidene-(5-methoxycarbonyl-1H-pyrrole-2-carbonyl)azanium |
|---|---|
| PubChem CID | 101018017 |
| Molecular Formula | C8H11N4O3+ |
| Molecular Weight | 211.20 g/mol |
| Exact Mass | 211.08 |
| IUPAC Name | diaminomethylidene-(5-methoxycarbonyl-1H-pyrrole-2-carbonyl)azanium |
| SMILES | COC(=O)c1ccc(C(=O)[NH+]=C(N)N)[nH]1 |
| InChI | InChI=1S/C8H10N4O3/c1-15-7(14)5-3-2-4(11-5)6(13)12-8(9)10/h2-3,11H,1H3,(H4,9,10,12,13)/p+1 |
| InChIKey | YTOYOODCNIPQSQ-UHFFFAOYSA-O |
| XLogP | -2.70 |
| TPSA | 125.17 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 211.20 |
| LogP ≤ 5 | -2.70 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|