C16H19N7O5 — CID 10526426
methyl 5-[2-[[5-(diaminomethylidenecarbamoyl)-1H-pyrrole-2-carbonyl]amino]ethylcarbamoyl]-1H-pyrrole-2-carboxylate (PubChem CID 10526426) has the molecular formula C16H19N7O5 and a molecular weight of 389.37 g/mol. Its IUPAC name is methyl 5-[2-[[5-(diaminomethylidenecarbamoyl)-1H-pyrrole-2-carbonyl]amino]ethylcarbamoyl]-1H-pyrrole-2-carboxylate.
| Compound Name | methyl 5-[2-[[5-(diaminomethylidenecarbamoyl)-1H-pyrrole-2-carbonyl]amino]ethylcarbamoyl]-1H-pyrrole-2-carboxylate |
|---|---|
| PubChem CID | 10526426 |
| Molecular Formula | C16H19N7O5 |
| Molecular Weight | 389.37 g/mol |
| Exact Mass | 389.14 |
| IUPAC Name | methyl 5-[2-[[5-(diaminomethylidenecarbamoyl)-1H-pyrrole-2-carbonyl]amino]ethylcarbamoyl]-1H-pyrrole-2-carboxylate |
| SMILES | COC(=O)c1ccc(C(=O)NCCNC(=O)c2ccc(C(=O)N=C(N)N)[nH]2)[nH]1 |
| InChI | InChI=1S/C16H19N7O5/c1-28-15(27)11-5-4-9(22-11)13(25)20-7-6-19-12(24)8-2-3-10(21-8)14(26)23-16(17)18/h2-5,21-22H,6-7H2,1H3,(H,19,24)(H,20,25)(H4,17,18,23,26) |
| InChIKey | GYRWLSZETBBNNS-UHFFFAOYSA-N |
| XLogP | -1.30 |
| TPSA | 197.55 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 389.37 |
| LogP ≤ 5 | -1.30 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|