C11H18N6O4 — CID 102209970
(2S)-2-amino-4-[[5-(diaminomethylcarbamoyl)-1H-pyrrole-2-carbonyl]amino]butanoic acid (PubChem CID 102209970) has the molecular formula C11H18N6O4 and a molecular weight of 298.30 g/mol. Its IUPAC name is (2S)-2-amino-4-[[5-(diaminomethylcarbamoyl)-1H-pyrrole-2-carbonyl]amino]butanoic acid.
| Compound Name | (2S)-2-amino-4-[[5-(diaminomethylcarbamoyl)-1H-pyrrole-2-carbonyl]amino]butanoic acid |
|---|---|
| PubChem CID | 102209970 |
| Molecular Formula | C11H18N6O4 |
| Molecular Weight | 298.30 g/mol |
| Exact Mass | 298.14 |
| IUPAC Name | (2S)-2-amino-4-[[5-(diaminomethylcarbamoyl)-1H-pyrrole-2-carbonyl]amino]butanoic acid |
| SMILES | NC(N)NC(=O)c1ccc(C(=O)NCC[C@H](N)C(=O)O)[nH]1 |
| InChI | InChI=1S/C11H18N6O4/c12-5(10(20)21)3-4-15-8(18)6-1-2-7(16-6)9(19)17-11(13)14/h1-2,5,11,16H,3-4,12-14H2,(H,15,18)(H,17,19)(H,20,21)/t5-/m0/s1 |
| InChIKey | YPMGAGZCDFMRGU-YFKPBYRVSA-N |
| XLogP | -2.52 |
| TPSA | 189.35 Ų |
| H-Bond Donors | 7 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.30 |
| LogP ≤ 5 | -2.52 |
| H-Bond Donors ≤ 5 | 7 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|