C15H24N6O4 — CID 163467849
2-amino-4-[[2-[2-[(3,4-diaminobenzoyl)amino]ethylamino]-2-oxoethyl]amino]butanoic acid (PubChem CID 163467849) has the molecular formula C15H24N6O4 and a molecular weight of 352.40 g/mol. Its IUPAC name is 2-amino-4-[[2-[2-[(3,4-diaminobenzoyl)amino]ethylamino]-2-oxoethyl]amino]butanoic acid.
| Compound Name | 2-amino-4-[[2-[2-[(3,4-diaminobenzoyl)amino]ethylamino]-2-oxoethyl]amino]butanoic acid |
|---|---|
| PubChem CID | 163467849 |
| Molecular Formula | C15H24N6O4 |
| Molecular Weight | 352.40 g/mol |
| Exact Mass | 352.19 |
| IUPAC Name | 2-amino-4-[[2-[2-[(3,4-diaminobenzoyl)amino]ethylamino]-2-oxoethyl]amino]butanoic acid |
| SMILES | Nc1ccc(C(=O)NCCNC(=O)CNCCC(N)C(=O)O)cc1N |
| InChI | InChI=1S/C15H24N6O4/c16-10-2-1-9(7-12(10)18)14(23)21-6-5-20-13(22)8-19-4-3-11(17)15(24)25/h1-2,7,11,19H,3-6,8,16-18H2,(H,20,22)(H,21,23)(H,24,25) |
| InChIKey | BUDDKTQHAGSRGM-UHFFFAOYSA-N |
| XLogP | -1.91 |
| TPSA | 185.59 Ų |
| H-Bond Donors | 7 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.40 |
| LogP ≤ 5 | -1.91 |
| H-Bond Donors ≤ 5 | 7 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|