C17H20N4O3 — CID 101231811
(2S)-2-amino-5-[[2-(4-methyl-2-pyridinyl)pyridine-4-carbonyl]amino]pentanoic acid (PubChem CID 101231811) has the molecular formula C17H20N4O3 and a molecular weight of 328.37 g/mol. Its IUPAC name is (2S)-2-amino-5-[[2-(4-methyl-2-pyridinyl)pyridine-4-carbonyl]amino]pentanoic acid.
| Compound Name | (2S)-2-amino-5-[[2-(4-methyl-2-pyridinyl)pyridine-4-carbonyl]amino]pentanoic acid |
|---|---|
| PubChem CID | 101231811 |
| Molecular Formula | C17H20N4O3 |
| Molecular Weight | 328.37 g/mol |
| Exact Mass | 328.15 |
| IUPAC Name | (2S)-2-amino-5-[[2-(4-methyl-2-pyridinyl)pyridine-4-carbonyl]amino]pentanoic acid |
| SMILES | Cc1ccnc(-c2cc(C(=O)NCCC[C@H](N)C(=O)O)ccn2)c1 |
| InChI | InChI=1S/C17H20N4O3/c1-11-4-7-19-14(9-11)15-10-12(5-8-20-15)16(22)21-6-2-3-13(18)17(23)24/h4-5,7-10,13H,2-3,6,18H2,1H3,(H,21,22)(H,23,24)/t13-/m0/s1 |
| InChIKey | BIKQRKFAIPLGGO-ZDUSSCGKSA-N |
| XLogP | 1.37 |
| TPSA | 118.20 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.37 |
| LogP ≤ 5 | 1.37 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|