C24H36N6O2 — CID 23251114
N-[2-(butylamino)ethyl]-2-[4-[2-(butylamino)ethylcarbamoyl]-2-pyridinyl]pyridine-4-carboxamide (PubChem CID 23251114) has the molecular formula C24H36N6O2 and a molecular weight of 440.59 g/mol. Its IUPAC name is N-[2-(butylamino)ethyl]-2-[4-[2-(butylamino)ethylcarbamoyl]-2-pyridinyl]pyridine-4-carboxamide.
| Compound Name | N-[2-(butylamino)ethyl]-2-[4-[2-(butylamino)ethylcarbamoyl]-2-pyridinyl]pyridine-4-carboxamide |
|---|---|
| PubChem CID | 23251114 |
| Molecular Formula | C24H36N6O2 |
| Molecular Weight | 440.59 g/mol |
| Exact Mass | 440.29 |
| IUPAC Name | N-[2-(butylamino)ethyl]-2-[4-[2-(butylamino)ethylcarbamoyl]-2-pyridinyl]pyridine-4-carboxamide |
| SMILES | CCCCNCCNC(=O)c1ccnc(-c2cc(C(=O)NCCNCCCC)ccn2)c1 |
| InChI | InChI=1S/C24H36N6O2/c1-3-5-9-25-13-15-29-23(31)19-7-11-27-21(17-19)22-18-20(8-12-28-22)24(32)30-16-14-26-10-6-4-2/h7-8,11-12,17-18,25-26H,3-6,9-10,13-16H2,1-2H3,(H,29,31)(H,30,32) |
| InChIKey | CSGCUJZXVZLSKS-UHFFFAOYSA-N |
| XLogP | 2.38 |
| TPSA | 108.04 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 440.59 |
| LogP ≤ 5 | 2.38 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|