C15H17N3O2 — CID 101019377
(7S,8R)-11-methyl-9,11,13-triazapentacyclo[6.5.2.22,7.02,7.09,13]heptadeca-3,14-diene-10,12-dione (PubChem CID 101019377) has the molecular formula C15H17N3O2 and a molecular weight of 271.32 g/mol. Its IUPAC name is (7S,8R)-11-methyl-9,11,13-triazapentacyclo[6.5.2.22,7.02,7.09,13]heptadeca-3,14-diene-10,12-dione.
| Compound Name | (7S,8R)-11-methyl-9,11,13-triazapentacyclo[6.5.2.22,7.02,7.09,13]heptadeca-3,14-diene-10,12-dione |
|---|---|
| PubChem CID | 101019377 |
| Molecular Formula | C15H17N3O2 |
| Molecular Weight | 271.32 g/mol |
| Exact Mass | 271.13 |
| IUPAC Name | (7S,8R)-11-methyl-9,11,13-triazapentacyclo[6.5.2.22,7.02,7.09,13]heptadeca-3,14-diene-10,12-dione |
| SMILES | Cn1c(=O)n2n(c1=O)[C@@H]1C=CC2C23C=CCC[C@@]12CC3 |
| InChI | InChI=1S/C15H17N3O2/c1-16-12(19)17-10-4-5-11(18(17)13(16)20)15-7-3-2-6-14(10,15)8-9-15/h2,4-6,10-11H,3,7-9H2,1H3/t10?,11-,14?,15-/m1/s1 |
| InChIKey | HDAATRUDEWNVEH-OGECIDPKSA-N |
| XLogP | 1.13 |
| TPSA | 48.93 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 271.32 |
| LogP ≤ 5 | 1.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|