C15H17N5O2 — CID 101019384
(1S,6R,7R)-11-methyl-4,5,9,11,13-pentazahexacyclo[6.5.2.22,7.23,6.02,7.09,13]nonadeca-4,14-diene-10,12-dione (PubChem CID 101019384) has the molecular formula C15H17N5O2 and a molecular weight of 299.33 g/mol. Its IUPAC name is (1S,6R,7R)-11-methyl-4,5,9,11,13-pentazahexacyclo[6.5.2.22,7.23,6.02,7.09,13]nonadeca-4,14-diene-10,12-dione.
| Compound Name | (1S,6R,7R)-11-methyl-4,5,9,11,13-pentazahexacyclo[6.5.2.22,7.23,6.02,7.09,13]nonadeca-4,14-diene-10,12-dione |
|---|---|
| PubChem CID | 101019384 |
| Molecular Formula | C15H17N5O2 |
| Molecular Weight | 299.33 g/mol |
| Exact Mass | 299.14 |
| IUPAC Name | (1S,6R,7R)-11-methyl-4,5,9,11,13-pentazahexacyclo[6.5.2.22,7.23,6.02,7.09,13]nonadeca-4,14-diene-10,12-dione |
| SMILES | Cn1c(=O)n2n(c1=O)[C@H]1C=CC2[C@@]23CCC12C1CC[C@H]3N=N1 |
| InChI | InChI=1S/C15H17N5O2/c1-18-12(21)19-10-4-5-11(20(19)13(18)22)15-7-6-14(10,15)8-2-3-9(15)17-16-8/h4-5,8-11H,2-3,6-7H2,1H3/t8-,9?,10?,11+,14+,15?/m1/s1 |
| InChIKey | ZRUWXPLQQSHCTB-IWQNXDPRSA-N |
| XLogP | 0.78 |
| TPSA | 73.65 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 299.33 |
| LogP ≤ 5 | 0.78 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|