C17H18 — CID 101026893
2,3,3a,4,5,6-hexahydro-1H-benzo[a]phenalene (PubChem CID 101026893) has the molecular formula C17H18 and a molecular weight of 222.33 g/mol. Its IUPAC name is 2,3,3a,4,5,6-hexahydro-1H-benzo[a]phenalene.
| Compound Name | 2,3,3a,4,5,6-hexahydro-1H-benzo[a]phenalene |
|---|---|
| PubChem CID | 101026893 |
| Molecular Formula | C17H18 |
| Molecular Weight | 222.33 g/mol |
| Exact Mass | 222.14 |
| IUPAC Name | 2,3,3a,4,5,6-hexahydro-1H-benzo[a]phenalene |
| SMILES | c1ccc2c3c4c(cc2c1)CCCC4CCC3 |
| InChI | InChI=1S/C17H18/c1-2-9-15-13(5-1)11-14-8-3-6-12-7-4-10-16(15)17(12)14/h1-2,5,9,11-12H,3-4,6-8,10H2 |
| InChIKey | VVAUMNANNLMSAY-UHFFFAOYSA-N |
| XLogP | 4.60 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 222.33 |
| LogP ≤ 5 | 4.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |