C11H15Cl2NO2 — CID 101028377
(1R,4S,8R)-8-butyl-4,6-dichloro-1-methyl-2-oxa-5-azabicyclo[2.2.2]oct-5-en-3-one (PubChem CID 101028377) has the molecular formula C11H15Cl2NO2 and a molecular weight of 264.15 g/mol. Its IUPAC name is (1R,4S,8R)-8-butyl-4,6-dichloro-1-methyl-2-oxa-5-azabicyclo[2.2.2]oct-5-en-3-one.
| Compound Name | (1R,4S,8R)-8-butyl-4,6-dichloro-1-methyl-2-oxa-5-azabicyclo[2.2.2]oct-5-en-3-one |
|---|---|
| PubChem CID | 101028377 |
| Molecular Formula | C11H15Cl2NO2 |
| Molecular Weight | 264.15 g/mol |
| Exact Mass | 263.05 |
| IUPAC Name | (1R,4S,8R)-8-butyl-4,6-dichloro-1-methyl-2-oxa-5-azabicyclo[2.2.2]oct-5-en-3-one |
| SMILES | CCCC[C@@H]1C[C@@]2(C)OC(=O)[C@]1(Cl)N=C2Cl |
| InChI | InChI=1S/C11H15Cl2NO2/c1-3-4-5-7-6-10(2)8(12)14-11(7,13)9(15)16-10/h7H,3-6H2,1-2H3/t7-,10-,11-/m1/s1 |
| InChIKey | DFAWEAAXZQRNIG-AVPPRXQKSA-N |
| XLogP | 3.08 |
| TPSA | 38.66 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 264.15 |
| LogP ≤ 5 | 3.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'N-C-halo', 'substructure': 'N/A'} |
|---|