C30H44Br2O2 — CID 101028843
2-[2,5-bis(bromomethyl)phenyl]-1,4-bis(2-ethylhexoxy)benzene (PubChem CID 101028843) has the molecular formula C30H44Br2O2 and a molecular weight of 596.49 g/mol. Its IUPAC name is 2-[2,5-bis(bromomethyl)phenyl]-1,4-bis(2-ethylhexoxy)benzene.
| Compound Name | 2-[2,5-bis(bromomethyl)phenyl]-1,4-bis(2-ethylhexoxy)benzene |
|---|---|
| PubChem CID | 101028843 |
| Molecular Formula | C30H44Br2O2 |
| Molecular Weight | 596.49 g/mol |
| Exact Mass | 594.17 |
| IUPAC Name | 2-[2,5-bis(bromomethyl)phenyl]-1,4-bis(2-ethylhexoxy)benzene |
| SMILES | CCCCC(CC)COc1ccc(OCC(CC)CCCC)c(-c2cc(CBr)ccc2CBr)c1 |
| InChI | InChI=1S/C30H44Br2O2/c1-5-9-11-23(7-3)21-33-27-15-16-30(34-22-24(8-4)12-10-6-2)29(18-27)28-17-25(19-31)13-14-26(28)20-32/h13-18,23-24H,5-12,19-22H2,1-4H3 |
| InChIKey | FMPKTCHYNAPNMK-UHFFFAOYSA-N |
| XLogP | 10.33 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 596.49 |
| LogP ≤ 5 | 10.33 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|