C29H42N2O2 — CID 22420496
2-[2,5-bis(2-ethylhexoxy)phenyl]-1H-benzimidazole (PubChem CID 22420496) has the molecular formula C29H42N2O2 and a molecular weight of 450.67 g/mol. Its IUPAC name is 2-[2,5-bis(2-ethylhexoxy)phenyl]-1H-benzimidazole.
| Compound Name | 2-[2,5-bis(2-ethylhexoxy)phenyl]-1H-benzimidazole |
|---|---|
| PubChem CID | 22420496 |
| Molecular Formula | C29H42N2O2 |
| Molecular Weight | 450.67 g/mol |
| Exact Mass | 450.32 |
| IUPAC Name | 2-[2,5-bis(2-ethylhexoxy)phenyl]-1H-benzimidazole |
| SMILES | CCCCC(CC)COc1ccc(OCC(CC)CCCC)c(-c2nc3ccccc3[nH]2)c1 |
| InChI | InChI=1S/C29H42N2O2/c1-5-9-13-22(7-3)20-32-24-17-18-28(33-21-23(8-4)14-10-6-2)25(19-24)29-30-26-15-11-12-16-27(26)31-29/h11-12,15-19,22-23H,5-10,13-14,20-21H2,1-4H3,(H,30,31) |
| InChIKey | JUGBPZZBKNPIAY-UHFFFAOYSA-N |
| XLogP | 8.42 |
| TPSA | 47.14 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 450.67 |
| LogP ≤ 5 | 8.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |