C16H30NNaO3 — CID 101028897
sodium N-[(1S)-1-carboxybutyl]undecanimidate (PubChem CID 101028897) has the molecular formula C16H30NNaO3 and a molecular weight of 307.41 g/mol. Its IUPAC name is sodium N-[(1S)-1-carboxybutyl]undecanimidate.
| Compound Name | sodium N-[(1S)-1-carboxybutyl]undecanimidate |
|---|---|
| PubChem CID | 101028897 |
| Molecular Formula | C16H30NNaO3 |
| Molecular Weight | 307.41 g/mol |
| Exact Mass | 307.21 |
| IUPAC Name | sodium N-[(1S)-1-carboxybutyl]undecanimidate |
| SMILES | CCCCCCCCCC/C([O-])=N/[C@@H](CCC)C(=O)O.[Na+] |
| InChI | InChI=1S/C16H31NO3.Na/c1-3-5-6-7-8-9-10-11-13-15(18)17-14(12-4-2)16(19)20;/h14H,3-13H2,1-2H3,(H,17,18)(H,19,20);/q;+1/p-1/t14-;/m0./s1 |
| InChIKey | JWXQOJYHURISEH-UQKRIMTDSA-M |
| XLogP | 0.53 |
| TPSA | 72.72 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 307.41 |
| LogP ≤ 5 | 0.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|