C15H21FO5 — CID 101028971
(2Z,4E)-5-[(1R,3S,4S,5S,8S)-4-fluoro-3,8-dihydroxy-1,5-dimethyl-6-oxabicyclo[3.2.1]octan-8-yl]-3-methylpenta-2,4-dienoic acid (PubChem CID 101028971) has the molecular formula C15H21FO5 and a molecular weight of 300.33 g/mol. Its IUPAC name is (2Z,4E)-5-[(1R,3S,4S,5S,8S)-4-fluoro-3,8-dihydroxy-1,5-dimethyl-6-oxabicyclo[3.2.1]octan-8-yl]-3-methylpenta-2,4-dienoic acid.
| Compound Name | (2Z,4E)-5-[(1R,3S,4S,5S,8S)-4-fluoro-3,8-dihydroxy-1,5-dimethyl-6-oxabicyclo[3.2.1]octan-8-yl]-3-methylpenta-2,4-dienoic acid |
|---|---|
| PubChem CID | 101028971 |
| Molecular Formula | C15H21FO5 |
| Molecular Weight | 300.33 g/mol |
| Exact Mass | 300.14 |
| IUPAC Name | (2Z,4E)-5-[(1R,3S,4S,5S,8S)-4-fluoro-3,8-dihydroxy-1,5-dimethyl-6-oxabicyclo[3.2.1]octan-8-yl]-3-methylpenta-2,4-dienoic acid |
| SMILES | CC(=C/C(=O)O)/C=C/[C@]1(O)[C@@]2(C)CO[C@]1(C)[C@@H](F)[C@@H](O)C2 |
| InChI | InChI=1S/C15H21FO5/c1-9(6-11(18)19)4-5-15(20)13(2)7-10(17)12(16)14(15,3)21-8-13/h4-6,10,12,17,20H,7-8H2,1-3H3,(H,18,19)/b5-4+,9-6-/t10-,12-,13+,14+,15-/m0/s1 |
| InChIKey | NNSJDIPMSBRNSI-MYXRDDPUSA-N |
| XLogP | 1.20 |
| TPSA | 86.99 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.33 |
| LogP ≤ 5 | 1.20 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|