C18H26ClNO4 — CID 101029639
methyl 8-chloro-2-methyl-3-(phenylmethoxycarbonylamino)octanoate (PubChem CID 101029639) has the molecular formula C18H26ClNO4 and a molecular weight of 355.86 g/mol. Its IUPAC name is methyl 8-chloro-2-methyl-3-(phenylmethoxycarbonylamino)octanoate.
| Compound Name | methyl 8-chloro-2-methyl-3-(phenylmethoxycarbonylamino)octanoate |
|---|---|
| PubChem CID | 101029639 |
| Molecular Formula | C18H26ClNO4 |
| Molecular Weight | 355.86 g/mol |
| Exact Mass | 355.16 |
| IUPAC Name | methyl 8-chloro-2-methyl-3-(phenylmethoxycarbonylamino)octanoate |
| SMILES | COC(=O)C(C)C(CCCCCCl)NC(=O)OCc1ccccc1 |
| InChI | InChI=1S/C18H26ClNO4/c1-14(17(21)23-2)16(11-7-4-8-12-19)20-18(22)24-13-15-9-5-3-6-10-15/h3,5-6,9-10,14,16H,4,7-8,11-13H2,1-2H3,(H,20,22) |
| InChIKey | RSKSPGKBIZTHQV-UHFFFAOYSA-N |
| XLogP | 3.89 |
| TPSA | 64.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 355.86 |
| LogP ≤ 5 | 3.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|