C22H25NO2 — CID 101030851
(4R,6S)-6-cyclohexyloxy-2,4-diphenyl-5,6-dihydro-4H-1,3-oxazine (PubChem CID 101030851) has the molecular formula C22H25NO2 and a molecular weight of 335.45 g/mol. Its IUPAC name is (4R,6S)-6-cyclohexyloxy-2,4-diphenyl-5,6-dihydro-4H-1,3-oxazine.
| Compound Name | (4R,6S)-6-cyclohexyloxy-2,4-diphenyl-5,6-dihydro-4H-1,3-oxazine |
|---|---|
| PubChem CID | 101030851 |
| Molecular Formula | C22H25NO2 |
| Molecular Weight | 335.45 g/mol |
| Exact Mass | 335.19 |
| IUPAC Name | (4R,6S)-6-cyclohexyloxy-2,4-diphenyl-5,6-dihydro-4H-1,3-oxazine |
| SMILES | c1ccc(C2=N[C@@H](c3ccccc3)C[C@@H](OC3CCCCC3)O2)cc1 |
| InChI | InChI=1S/C22H25NO2/c1-4-10-17(11-5-1)20-16-21(24-19-14-8-3-9-15-19)25-22(23-20)18-12-6-2-7-13-18/h1-2,4-7,10-13,19-21H,3,8-9,14-16H2/t20-,21+/m1/s1 |
| InChIKey | GXTWMRYGPMPZSB-RTWAWAEBSA-N |
| XLogP | 5.27 |
| TPSA | 30.82 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 335.45 |
| LogP ≤ 5 | 5.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |