C16H28O4 — CID 101035758
[(Z,2R)-3,6-dihydroxy-6-methyl-3-prop-1-en-2-ylhept-4-en-2-yl] 2,2-dimethylpropanoate (PubChem CID 101035758) has the molecular formula C16H28O4 and a molecular weight of 284.40 g/mol. Its IUPAC name is [(Z,2R)-3,6-dihydroxy-6-methyl-3-prop-1-en-2-ylhept-4-en-2-yl] 2,2-dimethylpropanoate.
| Compound Name | [(Z,2R)-3,6-dihydroxy-6-methyl-3-prop-1-en-2-ylhept-4-en-2-yl] 2,2-dimethylpropanoate |
|---|---|
| PubChem CID | 101035758 |
| Molecular Formula | C16H28O4 |
| Molecular Weight | 284.40 g/mol |
| Exact Mass | 284.20 |
| IUPAC Name | [(Z,2R)-3,6-dihydroxy-6-methyl-3-prop-1-en-2-ylhept-4-en-2-yl] 2,2-dimethylpropanoate |
| SMILES | C=C(C)C(O)(/C=C\C(C)(C)O)[C@@H](C)OC(=O)C(C)(C)C |
| InChI | InChI=1S/C16H28O4/c1-11(2)16(19,10-9-15(7,8)18)12(3)20-13(17)14(4,5)6/h9-10,12,18-19H,1H2,2-8H3/b10-9-/t12-,16?/m1/s1 |
| InChIKey | XFGURXQRABEBES-OSEPLDFOSA-N |
| XLogP | 2.60 |
| TPSA | 66.76 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 284.40 |
| LogP ≤ 5 | 2.60 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|