C9H15Cl3O3Si — CID 10780938
[(2R)-3-trichlorosilyloxybut-3-en-2-yl] 2,2-dimethylpropanoate (PubChem CID 10780938) has the molecular formula C9H15Cl3O3Si and a molecular weight of 305.66 g/mol. Its IUPAC name is [(2R)-3-trichlorosilyloxybut-3-en-2-yl] 2,2-dimethylpropanoate.
| Compound Name | [(2R)-3-trichlorosilyloxybut-3-en-2-yl] 2,2-dimethylpropanoate |
|---|---|
| PubChem CID | 10780938 |
| Molecular Formula | C9H15Cl3O3Si |
| Molecular Weight | 305.66 g/mol |
| Exact Mass | 303.99 |
| IUPAC Name | [(2R)-3-trichlorosilyloxybut-3-en-2-yl] 2,2-dimethylpropanoate |
| SMILES | C=C(O[Si](Cl)(Cl)Cl)[C@@H](C)OC(=O)C(C)(C)C |
| InChI | InChI=1S/C9H15Cl3O3Si/c1-6(7(2)15-16(10,11)12)14-8(13)9(3,4)5/h6H,2H2,1,3-5H3/t6-/m1/s1 |
| InChIKey | PWAXUAQNGMLQPT-ZCFIWIBFSA-N |
| XLogP | 3.65 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 305.66 |
| LogP ≤ 5 | 3.65 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'silicon_halogen', 'substructure': 'N/A'} |
|---|