C21H20NO6+ — CID 101036654
(13S)-3-methoxy-13-methyl-5,7,17,19-tetraoxa-13-azoniahexacyclo[11.11.0.02,10.04,8.015,23.016,20]tetracosa-2,4(8),9,15(23),16(20),21-hexaen-24-one (PubChem CID 101036654) has the molecular formula C21H20NO6+ and a molecular weight of 382.39 g/mol. Its IUPAC name is (13S)-3-methoxy-13-methyl-5,7,17,19-tetraoxa-13-azoniahexacyclo[11.11.0.02,10.04,8.015,23.016,20]tetracosa-2,4(8),9,15(23),16(20),21-hexaen-24-one.
| Compound Name | (13S)-3-methoxy-13-methyl-5,7,17,19-tetraoxa-13-azoniahexacyclo[11.11.0.02,10.04,8.015,23.016,20]tetracosa-2,4(8),9,15(23),16(20),21-hexaen-24-one |
|---|---|
| PubChem CID | 101036654 |
| Molecular Formula | C21H20NO6+ |
| Molecular Weight | 382.39 g/mol |
| Exact Mass | 382.13 |
| IUPAC Name | (13S)-3-methoxy-13-methyl-5,7,17,19-tetraoxa-13-azoniahexacyclo[11.11.0.02,10.04,8.015,23.016,20]tetracosa-2,4(8),9,15(23),16(20),21-hexaen-24-one |
| SMILES | COc1c2c(cc3c1C1C(=O)c4ccc5c(c4C[N@+]1(C)CC3)OCO5)OCO2 |
| InChI | InChI=1S/C21H20NO6/c1-22-6-5-11-7-15-20(28-10-26-15)21(24-2)16(11)17(22)18(23)12-3-4-14-19(13(12)8-22)27-9-25-14/h3-4,7,17H,5-6,8-10H2,1-2H3/q+1/t17?,22-/m0/s1 |
| InChIKey | SFKICQDFOFOUIY-UGNFMNBCSA-N |
| XLogP | 2.59 |
| TPSA | 63.22 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.39 |
| LogP ≤ 5 | 2.59 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|