C24H26NO6+ — CID 40854920
3-methoxy-4-[3-[(5S)-4-methoxy-6,6-dimethyl-7,8-dihydro-5H-[1,3]dioxolo[4,5-g]isoquinolin-6-ium-5-yl]prop-2-ynoxy]benzaldehyde (PubChem CID 40854920) has the molecular formula C24H26NO6+ and a molecular weight of 424.47 g/mol. Its IUPAC name is 3-methoxy-4-[3-[(5S)-4-methoxy-6,6-dimethyl-7,8-dihydro-5H-[1,3]dioxolo[4,5-g]isoquinolin-6-ium-5-yl]prop-2-ynoxy]benzaldehyde.
| Compound Name | 3-methoxy-4-[3-[(5S)-4-methoxy-6,6-dimethyl-7,8-dihydro-5H-[1,3]dioxolo[4,5-g]isoquinolin-6-ium-5-yl]prop-2-ynoxy]benzaldehyde |
|---|---|
| PubChem CID | 40854920 |
| Molecular Formula | C24H26NO6+ |
| Molecular Weight | 424.47 g/mol |
| Exact Mass | 424.18 |
| IUPAC Name | 3-methoxy-4-[3-[(5S)-4-methoxy-6,6-dimethyl-7,8-dihydro-5H-[1,3]dioxolo[4,5-g]isoquinolin-6-ium-5-yl]prop-2-ynoxy]benzaldehyde |
| SMILES | COc1cc(C=O)ccc1OCC#C[C@H]1c2c(cc3c(c2OC)OCO3)CC[N+]1(C)C |
| InChI | InChI=1S/C24H26NO6/c1-25(2)10-9-17-13-21-23(31-15-30-21)24(28-4)22(17)18(25)6-5-11-29-19-8-7-16(14-26)12-20(19)27-3/h7-8,12-14,18H,9-11,15H2,1-4H3/q+1/t18-/m0/s1 |
| InChIKey | HLGGRVCZOPVRNO-SFHVURJKSA-N |
| XLogP | 3.00 |
| TPSA | 63.22 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 424.47 |
| LogP ≤ 5 | 3.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|