C21H23IN2O3 — CID 15549569
5-indol-1-yl-4-methoxy-6,6-dimethyl-7,8-dihydro-5H-[1,3]dioxolo[4,5-g]isoquinolin-6-ium iodide (PubChem CID 15549569) has the molecular formula C21H23IN2O3 and a molecular weight of 478.33 g/mol. Its IUPAC name is 5-indol-1-yl-4-methoxy-6,6-dimethyl-7,8-dihydro-5H-[1,3]dioxolo[4,5-g]isoquinolin-6-ium iodide.
| Compound Name | 5-indol-1-yl-4-methoxy-6,6-dimethyl-7,8-dihydro-5H-[1,3]dioxolo[4,5-g]isoquinolin-6-ium iodide |
|---|---|
| PubChem CID | 15549569 |
| Molecular Formula | C21H23IN2O3 |
| Molecular Weight | 478.33 g/mol |
| Exact Mass | 478.08 |
| IUPAC Name | 5-indol-1-yl-4-methoxy-6,6-dimethyl-7,8-dihydro-5H-[1,3]dioxolo[4,5-g]isoquinolin-6-ium iodide |
| SMILES | COc1c2c(cc3c1C(n1ccc4ccccc41)[N+](C)(C)CC3)OCO2.[I-] |
| InChI | InChI=1S/C21H23N2O3.HI/c1-23(2)11-9-15-12-17-19(26-13-25-17)20(24-3)18(15)21(23)22-10-8-14-6-4-5-7-16(14)22;/h4-8,10,12,21H,9,11,13H2,1-3H3;1H/q+1;/p-1 |
| InChIKey | FBSFCWMAKVIZIY-UHFFFAOYSA-M |
| XLogP | 0.56 |
| TPSA | 32.62 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 478.33 |
| LogP ≤ 5 | 0.56 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|