C22H25BNO6+ — CID 91805446
CID 91805446 (PubChem CID 91805446) has the molecular formula C22H25BNO6+ and a molecular weight of 410.26 g/mol.
| Compound Name | CID 91805446 |
|---|---|
| PubChem CID | 91805446 |
| Molecular Formula | C22H25BNO6+ |
| Molecular Weight | 410.26 g/mol |
| Exact Mass | 410.18 |
| IUPAC Name | — |
| SMILES | [B][N+]1(C)CCc2cc3c(c(OC)c2[C@@H]1C1OCc2c1ccc(OC)c2OC)OCO3 |
| InChI | InChI=1S/C22H25BNO6/c1-24(23)8-7-12-9-16-21(30-11-29-16)22(27-4)17(12)18(24)20-13-5-6-15(25-2)19(26-3)14(13)10-28-20/h5-6,9,18,20H,7-8,10-11H2,1-4H3/q+1/t18-,20?,24?/m1/s1 |
| InChIKey | BTUPWDJKDWDWAM-NWKXHEKXSA-N |
| XLogP | 2.84 |
| TPSA | 55.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.26 |
| LogP ≤ 5 | 2.84 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|