C28H27NO8 — CID 71506452
phenyl (5R)-5-[(1S)-4,5-dimethoxy-1,3-dihydro-2-benzofuran-1-yl]-4-methoxy-7,8-dihydro-5H-[1,3]dioxolo[4,5-g]isoquinoline-6-carboxylate (PubChem CID 71506452) has the molecular formula C28H27NO8 and a molecular weight of 505.52 g/mol. Its IUPAC name is phenyl (5R)-5-[(1S)-4,5-dimethoxy-1,3-dihydro-2-benzofuran-1-yl]-4-methoxy-7,8-dihydro-5H-[1,3]dioxolo[4,5-g]isoquinoline-6-carboxylate.
| Compound Name | phenyl (5R)-5-[(1S)-4,5-dimethoxy-1,3-dihydro-2-benzofuran-1-yl]-4-methoxy-7,8-dihydro-5H-[1,3]dioxolo[4,5-g]isoquinoline-6-carboxylate |
|---|---|
| PubChem CID | 71506452 |
| Molecular Formula | C28H27NO8 |
| Molecular Weight | 505.52 g/mol |
| Exact Mass | 505.17 |
| IUPAC Name | phenyl (5R)-5-[(1S)-4,5-dimethoxy-1,3-dihydro-2-benzofuran-1-yl]-4-methoxy-7,8-dihydro-5H-[1,3]dioxolo[4,5-g]isoquinoline-6-carboxylate |
| SMILES | COc1ccc2c(c1OC)CO[C@@H]2[C@H]1c2c(cc3c(c2OC)OCO3)CCN1C(=O)Oc1ccccc1 |
| InChI | InChI=1S/C28H27NO8/c1-31-20-10-9-18-19(24(20)32-2)14-34-25(18)23-22-16(13-21-26(27(22)33-3)36-15-35-21)11-12-29(23)28(30)37-17-7-5-4-6-8-17/h4-10,13,23,25H,11-12,14-15H2,1-3H3/t23-,25+/m1/s1 |
| InChIKey | AJDYYUDQBORAEU-NOZRDPDXSA-N |
| XLogP | 4.81 |
| TPSA | 84.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 505.52 |
| LogP ≤ 5 | 4.81 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |