C27H34N2O7 — CID 71506456
(5R)-5-[(1S)-4,5-dimethoxy-1,3-dihydro-2-benzofuran-1-yl]-4-methoxy-N-pentyl-7,8-dihydro-5H-[1,3]dioxolo[4,5-g]isoquinoline-6-carboxamide (PubChem CID 71506456) has the molecular formula C27H34N2O7 and a molecular weight of 498.58 g/mol. Its IUPAC name is (5R)-5-[(1S)-4,5-dimethoxy-1,3-dihydro-2-benzofuran-1-yl]-4-methoxy-N-pentyl-7,8-dihydro-5H-[1,3]dioxolo[4,5-g]isoquinoline-6-carboxamide.
| Compound Name | (5R)-5-[(1S)-4,5-dimethoxy-1,3-dihydro-2-benzofuran-1-yl]-4-methoxy-N-pentyl-7,8-dihydro-5H-[1,3]dioxolo[4,5-g]isoquinoline-6-carboxamide |
|---|---|
| PubChem CID | 71506456 |
| Molecular Formula | C27H34N2O7 |
| Molecular Weight | 498.58 g/mol |
| Exact Mass | 498.24 |
| IUPAC Name | (5R)-5-[(1S)-4,5-dimethoxy-1,3-dihydro-2-benzofuran-1-yl]-4-methoxy-N-pentyl-7,8-dihydro-5H-[1,3]dioxolo[4,5-g]isoquinoline-6-carboxamide |
| SMILES | CCCCCNC(=O)N1CCc2cc3c(c(OC)c2[C@@H]1[C@H]1OCc2c1ccc(OC)c2OC)OCO3 |
| InChI | InChI=1S/C27H34N2O7/c1-5-6-7-11-28-27(30)29-12-10-16-13-20-25(36-15-35-20)26(33-4)21(16)22(29)24-17-8-9-19(31-2)23(32-3)18(17)14-34-24/h8-9,13,22,24H,5-7,10-12,14-15H2,1-4H3,(H,28,30)/t22-,24+/m1/s1 |
| InChIKey | VVKPPLAPIJCQAN-VWNXMTODSA-N |
| XLogP | 4.51 |
| TPSA | 87.72 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 498.58 |
| LogP ≤ 5 | 4.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|