C28H27ClN2O6S — CID 71504081
(5R)-N-(4-chlorophenyl)-5-[(1S)-4,5-dimethoxy-1,3-dihydro-2-benzofuran-1-yl]-4-methoxy-7,8-dihydro-5H-[1,3]dioxolo[4,5-g]isoquinoline-6-carbothioamide (PubChem CID 71504081) has the molecular formula C28H27ClN2O6S and a molecular weight of 555.05 g/mol. Its IUPAC name is (5R)-N-(4-chlorophenyl)-5-[(1S)-4,5-dimethoxy-1,3-dihydro-2-benzofuran-1-yl]-4-methoxy-7,8-dihydro-5H-[1,3]dioxolo[4,5-g]isoquinoline-6-carbothioamide.
| Compound Name | (5R)-N-(4-chlorophenyl)-5-[(1S)-4,5-dimethoxy-1,3-dihydro-2-benzofuran-1-yl]-4-methoxy-7,8-dihydro-5H-[1,3]dioxolo[4,5-g]isoquinoline-6-carbothioamide |
|---|---|
| PubChem CID | 71504081 |
| Molecular Formula | C28H27ClN2O6S |
| Molecular Weight | 555.05 g/mol |
| Exact Mass | 554.13 |
| IUPAC Name | (5R)-N-(4-chlorophenyl)-5-[(1S)-4,5-dimethoxy-1,3-dihydro-2-benzofuran-1-yl]-4-methoxy-7,8-dihydro-5H-[1,3]dioxolo[4,5-g]isoquinoline-6-carbothioamide |
| SMILES | COc1ccc2c(c1OC)CO[C@@H]2[C@H]1c2c(cc3c(c2OC)OCO3)CCN1C(=S)Nc1ccc(Cl)cc1 |
| InChI | InChI=1S/C28H27ClN2O6S/c1-32-20-9-8-18-19(24(20)33-2)13-35-25(18)23-22-15(12-21-26(27(22)34-3)37-14-36-21)10-11-31(23)28(38)30-17-6-4-16(29)5-7-17/h4-9,12,23,25H,10-11,13-14H2,1-3H3,(H,30,38)/t23-,25+/m1/s1 |
| InChIKey | GHZZYCGGGZSCOR-NOZRDPDXSA-N |
| XLogP | 5.66 |
| TPSA | 70.65 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 555.05 |
| LogP ≤ 5 | 5.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|