C18H28FO5PS — CID 101038522
[(E)-1-diethoxyphosphoryl-1-fluorooct-1-en-2-yl]sulfonylbenzene (PubChem CID 101038522) has the molecular formula C18H28FO5PS and a molecular weight of 406.46 g/mol. Its IUPAC name is [(E)-1-diethoxyphosphoryl-1-fluorooct-1-en-2-yl]sulfonylbenzene.
| Compound Name | [(E)-1-diethoxyphosphoryl-1-fluorooct-1-en-2-yl]sulfonylbenzene |
|---|---|
| PubChem CID | 101038522 |
| Molecular Formula | C18H28FO5PS |
| Molecular Weight | 406.46 g/mol |
| Exact Mass | 406.14 |
| IUPAC Name | [(E)-1-diethoxyphosphoryl-1-fluorooct-1-en-2-yl]sulfonylbenzene |
| SMILES | CCCCCC/C(=C(/F)P(=O)(OCC)OCC)S(=O)(=O)c1ccccc1 |
| InChI | InChI=1S/C18H28FO5PS/c1-4-7-8-12-15-17(18(19)25(20,23-5-2)24-6-3)26(21,22)16-13-10-9-11-14-16/h9-11,13-14H,4-8,12,15H2,1-3H3/b18-17+ |
| InChIKey | HEQPUULSPVOOME-ISLYRVAYSA-N |
| XLogP | 5.84 |
| TPSA | 69.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.46 |
| LogP ≤ 5 | 5.84 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|