C13H21N4O9P — CID 101038719
(2,3-diamino-3-oxopropyl) [(2R,3S,5R)-3-hydroxy-5-(5-methyl-2,4-dioxopyrimidin-1-yl)oxolan-2-yl]methyl hydrogen phosphate (PubChem CID 101038719) has the molecular formula C13H21N4O9P and a molecular weight of 408.30 g/mol. Its IUPAC name is (2,3-diamino-3-oxopropyl) [(2R,3S,5R)-3-hydroxy-5-(5-methyl-2,4-dioxopyrimidin-1-yl)oxolan-2-yl]methyl hydrogen phosphate.
| Compound Name | (2,3-diamino-3-oxopropyl) [(2R,3S,5R)-3-hydroxy-5-(5-methyl-2,4-dioxopyrimidin-1-yl)oxolan-2-yl]methyl hydrogen phosphate |
|---|---|
| PubChem CID | 101038719 |
| Molecular Formula | C13H21N4O9P |
| Molecular Weight | 408.30 g/mol |
| Exact Mass | 408.10 |
| IUPAC Name | (2,3-diamino-3-oxopropyl) [(2R,3S,5R)-3-hydroxy-5-(5-methyl-2,4-dioxopyrimidin-1-yl)oxolan-2-yl]methyl hydrogen phosphate |
| SMILES | Cc1cn([C@H]2C[C@H](O)[C@@H](COP(=O)(O)OCC(N)C(N)=O)O2)c(=O)[nH]c1=O |
| InChI | InChI=1S/C13H21N4O9P/c1-6-3-17(13(21)16-12(6)20)10-2-8(18)9(26-10)5-25-27(22,23)24-4-7(14)11(15)19/h3,7-10,18H,2,4-5,14H2,1H3,(H2,15,19)(H,22,23)(H,16,20,21)/t7?,8-,9+,10+/m0/s1 |
| InChIKey | QBXTUQLGYJRBHM-HCZOVWHVSA-N |
| XLogP | -2.56 |
| TPSA | 209.19 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.30 |
| LogP ≤ 5 | -2.56 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|