C21H30O3 — CID 101039083
methyl (Z)-2-[(E)-2-[(8aS)-2,5,5,8a-tetramethyl-3,4,4a,6,7,8-hexahydronaphthalen-1-yl]ethenyl]-4-oxobut-2-enoate (PubChem CID 101039083) has the molecular formula C21H30O3 and a molecular weight of 330.47 g/mol. Its IUPAC name is methyl (Z)-2-[(E)-2-[(8aS)-2,5,5,8a-tetramethyl-3,4,4a,6,7,8-hexahydronaphthalen-1-yl]ethenyl]-4-oxobut-2-enoate.
| Compound Name | methyl (Z)-2-[(E)-2-[(8aS)-2,5,5,8a-tetramethyl-3,4,4a,6,7,8-hexahydronaphthalen-1-yl]ethenyl]-4-oxobut-2-enoate |
|---|---|
| PubChem CID | 101039083 |
| Molecular Formula | C21H30O3 |
| Molecular Weight | 330.47 g/mol |
| Exact Mass | 330.22 |
| IUPAC Name | methyl (Z)-2-[(E)-2-[(8aS)-2,5,5,8a-tetramethyl-3,4,4a,6,7,8-hexahydronaphthalen-1-yl]ethenyl]-4-oxobut-2-enoate |
| SMILES | COC(=O)C(=C\C=O)/C=C/C1=C(C)CCC2C(C)(C)CCC[C@]12C |
| InChI | InChI=1S/C21H30O3/c1-15-7-10-18-20(2,3)12-6-13-21(18,4)17(15)9-8-16(11-14-22)19(23)24-5/h8-9,11,14,18H,6-7,10,12-13H2,1-5H3/b9-8+,16-11-/t18?,21-/m1/s1 |
| InChIKey | OKSRKJDSUFTILJ-YGJGNITNSA-N |
| XLogP | 4.78 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.47 |
| LogP ≤ 5 | 4.78 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|