C7H12O2 — CID 101043296
cis-(1S,3R)-4-methylidenecyclohexane-1,3-diol (PubChem CID 101043296) has the molecular formula C7H12O2 and a molecular weight of 128.17 g/mol. Its IUPAC name is cis-(1S,3R)-4-methylidenecyclohexane-1,3-diol.
| Compound Name | cis-(1S,3R)-4-methylidenecyclohexane-1,3-diol |
|---|---|
| PubChem CID | 101043296 |
| Molecular Formula | C7H12O2 |
| Molecular Weight | 128.17 g/mol |
| Exact Mass | 128.08 |
| IUPAC Name | cis-(1S,3R)-4-methylidenecyclohexane-1,3-diol |
| SMILES | C=C1CC[C@H](O)C[C@H]1O |
| InChI | InChI=1S/C7H12O2/c1-5-2-3-6(8)4-7(5)9/h6-9H,1-4H2/t6-,7+/m0/s1 |
| InChIKey | DGNVHKXTWZBCHF-NKWVEPMBSA-N |
| XLogP | 0.45 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 9 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 128.17 |
| LogP ≤ 5 | 0.45 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|