C11H20O — CID 12027036
cis-(1S,5R)-5-tert-butyl-2-methylidenecyclohexan-1-ol (PubChem CID 12027036) has the molecular formula C11H20O and a molecular weight of 168.28 g/mol. Its IUPAC name is cis-(1S,5R)-5-tert-butyl-2-methylidenecyclohexan-1-ol.
| Compound Name | cis-(1S,5R)-5-tert-butyl-2-methylidenecyclohexan-1-ol |
|---|---|
| PubChem CID | 12027036 |
| Molecular Formula | C11H20O |
| Molecular Weight | 168.28 g/mol |
| Exact Mass | 168.15 |
| IUPAC Name | cis-(1S,5R)-5-tert-butyl-2-methylidenecyclohexan-1-ol |
| SMILES | C=C1CC[C@@H](C(C)(C)C)C[C@@H]1O |
| InChI | InChI=1S/C11H20O/c1-8-5-6-9(7-10(8)12)11(2,3)4/h9-10,12H,1,5-7H2,2-4H3/t9-,10+/m1/s1 |
| InChIKey | MKWJZCGGUSWUQL-ZJUUUORDSA-N |
| XLogP | 2.75 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 168.28 |
| LogP ≤ 5 | 2.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|